[diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate
- CAS:67210-66-6
- purity:99%
Details
Factory sells [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate 67210-66-6 with sufficient production capacity We provide high quality [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate (CAS 67210-66-6), at a very affordable prices to our customers.
1.What is the [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate ?
[diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate is a complex chemical compound that consists of diethyl ammonium combined with 4-methyl-2-oxo-2H-benzopyran-7-yl and hydrogen sulphate. The diethyl ammonium component is made up of two ethyl groups attached to an ammonium cation, while the 4-methyl-2-oxo-2H-benzopyran-7-yl is a derivative of a benzopyran compound featuring a methyl group and a ketone functional group. The hydrogen sulphate component imparts an acidic characteristic to the compound. This unique composition and properties of the chemical likely make it suitable for various applications across different industries.
Used in Pharmaceutical Industry:
[diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate is used as a pharmaceutical agent for its potential medicinal properties. [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate's unique structure may allow it to interact with biological targets, offering therapeutic benefits in treating specific conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate serves as a key intermediate or reagent in the production of other complex organic compounds. Its versatile structure and acidic nature make it a valuable component in creating new molecules with desired properties.
Used in Material Science:
[diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate is utilized in material science as a component in the development of new materials with specific characteristics. Its ability to form complexes and interact with other molecules can contribute to the creation of advanced materials with applications in various industries.
Used in Analytical Chemistry:
This complex chemical compound is employed in analytical chemistry as a reagent or analytical standard. Its distinct properties can be leveraged to develop new methods for detecting, quantifying, or analyzing other substances in various samples.
Used in Environmental Applications:
[diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate may be used in environmental applications, such as water treatment or soil remediation, due to its ability to interact with pollutants and contaminants. Its acidic nature and complex structure can help in the removal or neutralization of harmful substances in the environment.
2.What is the CAS number for [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate ?
The CAS number of [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate is 67210-66-6.
More information of [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate 67210-66-6 are:
|
CAS?Number |
67210-66-6 |
|
Density |
g/cm3 |
|
Boiling Point |
391.7°Cat760mmHg |
|
Flash Point |
152°C |
|
Vapor Pressure |
2.43E-06mmHg at 25°C |
|
PSA |
116.43000 |
|
LogP |
3.37560 |
3.What is the molecular formula of [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate ?
The chemical formula of?[diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate is C14H17NO2•H2O4S which containing 14 Carbon atoms,19 Hydrogen atoms,1 Nitrogen atoms,5 Oxygen atoms and 1 Sulfur atoms,and the molecular weight, and the molecular weight of [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate is 329.40
4.What is [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate(67210-66-6)used for?
[diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate is a complex chemical compound that consists of diethyl ammonium combined with 4-methyl-2-oxo-2H-benzopyran-7-yl and hydrogen sulphate. The diethyl ammonium component is made up of two ethyl groups attached to an ammonium cation, while the 4-methyl-2-oxo-2H-benzopyran-7-yl is a derivative of a benzopyran compound featuring a methyl group and a ketone functional group. The hydrogen sulphate component imparts an acidic characteristic to the compound. This unique composition and properties of the chemical likely make it suitable for various applications across different industries.
InChI:InChI=1/C14H17NO2.H2O4S/c1-4-15(5-2)11-6-7-12-10(3)8-14(16)17-13(12)9-11;1-5(2,3)4/h6-9H,4-5H2,1-3H3;(H2,1,2,3,4)
Relevant articles related to [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate:
5.Factory sells [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate 67210-66-6 with sufficient production capacity
Zhongshan Yuanhang E-Commercial Co., Ltd. is a quality supplier of [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on [diethyl(4-methyl-2-oxo-2H-benzopyran-7-yl)]ammonium hydrogen sulphate 67210-66-6.
Related Products
-
3-amino-7-(diethylamino)-2-methylphenoxazin-5-ium chloride
CAS:55973-87-0
-
FERROUS FLUOBORATE
CAS:15283-51-9